C9H15F2N3OS — CID 103151219
3-[2-(2,2-difluoroethoxy)ethyl]-N-propan-2-yl-1,2,4-thiadiazol-5-amine (PubChem CID 103151219) has the molecular formula C9H15F2N3OS and a molecular weight of 251.30 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethoxy)ethyl]-N-propan-2-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-[2-(2,2-difluoroethoxy)ethyl]-N-propan-2-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 103151219 |
| Molecular Formula | C9H15F2N3OS |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 3-[2-(2,2-difluoroethoxy)ethyl]-N-propan-2-yl-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)Nc1nc(CCOCC(F)F)ns1 |
| InChI | InChI=1S/C9H15F2N3OS/c1-6(2)12-9-13-8(14-16-9)3-4-15-5-7(10)11/h6-7H,3-5H2,1-2H3,(H,12,13,14) |
| InChIKey | ITMNJIURAAUIEF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|