C10H17F2N3OS — CID 103151223
3-[2-(2,2-difluoroethoxy)ethyl]-N-(2-methylpropyl)-1,2,4-thiadiazol-5-amine (PubChem CID 103151223) has the molecular formula C10H17F2N3OS and a molecular weight of 265.33 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethoxy)ethyl]-N-(2-methylpropyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-[2-(2,2-difluoroethoxy)ethyl]-N-(2-methylpropyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 103151223 |
| Molecular Formula | C10H17F2N3OS |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3-[2-(2,2-difluoroethoxy)ethyl]-N-(2-methylpropyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)CNc1nc(CCOCC(F)F)ns1 |
| InChI | InChI=1S/C10H17F2N3OS/c1-7(2)5-13-10-14-9(15-17-10)3-4-16-6-8(11)12/h7-8H,3-6H2,1-2H3,(H,13,14,15) |
| InChIKey | KQVCYQUDYQEZNX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|