About [2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanol
[2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanol (PubChem CID 103151228) has the molecular formula C8H11F2NO2S
and a molecular weight of 223.24 g/mol. Its IUPAC name is [2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanol.
Molecular Properties
| Compound Name | [2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanol |
| PubChem CID | 103151228 |
| Molecular Formula | C8H11F2NO2S |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | [2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanol |
| SMILES | OCc1cnc(CCOCC(F)F)s1 |
| InChI | InChI=1S/C8H11F2NO2S/c9-7(10)5-13-2-1-8-11-3-6(4-12)14-8/h3,7,12H,1-2,4-5H2 |
| InChIKey | PUPKOJLWJSPOHM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanol?
The IUPAC name of [2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanol (CID 103151228) is [2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanol.
What is the SMILES notation for [2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanol?
The canonical SMILES for [2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanol is OCc1cnc(CCOCC(F)F)s1.
What is the InChIKey of [2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanol?
The InChIKey is PUPKOJLWJSPOHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F2NO2S/c9-7(10)5-13-2-1-8-11-3-6(4-12)14-8/h3,7,12H,1-2,4-5H2.
What are the key properties of [2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanol?
[2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanol has a molecular weight of 223.24 g/mol, XLogP of 1.46, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-5-yl]methanol is sourced from PubChem (CID 103151228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).