C10H13F2NOS — CID 103151261
4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazole (PubChem CID 103151261) has the molecular formula C10H13F2NOS and a molecular weight of 233.28 g/mol. Its IUPAC name is 4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazole.
| Compound Name | 4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 103151261 |
| Molecular Formula | C10H13F2NOS |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazole |
| SMILES | FC(F)COCCc1nc(C2CC2)cs1 |
| InChI | InChI=1S/C10H13F2NOS/c11-9(12)5-14-4-3-10-13-8(6-15-10)7-1-2-7/h6-7,9H,1-5H2 |
| InChIKey | MMXGNWKDHDKDAM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|