C10H12F3NOS — CID 103151262
4-cyclopropyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazole (PubChem CID 103151262) has the molecular formula C10H12F3NOS and a molecular weight of 251.27 g/mol. Its IUPAC name is 4-cyclopropyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazole.
| Compound Name | 4-cyclopropyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 103151262 |
| Molecular Formula | C10H12F3NOS |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 4-cyclopropyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazole |
| SMILES | FC(F)(F)COCCc1nc(C2CC2)cs1 |
| InChI | InChI=1S/C10H12F3NOS/c11-10(12,13)6-15-4-3-9-14-8(5-16-9)7-1-2-7/h5,7H,1-4,6H2 |
| InChIKey | VKGVRTIEYGQUFP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|