C12H17F3N2O2S — CID 103151292
4-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]oxan-4-amine (PubChem CID 103151292) has the molecular formula C12H17F3N2O2S and a molecular weight of 310.34 g/mol. Its IUPAC name is 4-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]oxan-4-amine.
| Compound Name | 4-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]oxan-4-amine |
|---|---|
| PubChem CID | 103151292 |
| Molecular Formula | C12H17F3N2O2S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]oxan-4-amine |
| SMILES | NC1(c2csc(CCOCC(F)(F)F)n2)CCOCC1 |
| InChI | InChI=1S/C12H17F3N2O2S/c13-12(14,15)8-19-4-1-10-17-9(7-20-10)11(16)2-5-18-6-3-11/h7H,1-6,8,16H2 |
| InChIKey | OKFKHYASDOXDEA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|