C12H19F3N2OS — CID 103151302
N-ethyl-2-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]propan-1-amine (PubChem CID 103151302) has the molecular formula C12H19F3N2OS and a molecular weight of 296.36 g/mol. Its IUPAC name is N-ethyl-2-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]propan-1-amine.
| Compound Name | N-ethyl-2-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 103151302 |
| Molecular Formula | C12H19F3N2OS |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-ethyl-2-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]propan-1-amine |
| SMILES | CCNCC(C)c1csc(CCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C12H19F3N2OS/c1-3-16-6-9(2)10-7-19-11(17-10)4-5-18-8-12(13,14)15/h7,9,16H,3-6,8H2,1-2H3 |
| InChIKey | SNIQYJZLVYZTCB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|