C12H17F3N2OS — CID 103151318
1-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]cyclopentan-1-amine (PubChem CID 103151318) has the molecular formula C12H17F3N2OS and a molecular weight of 294.34 g/mol. Its IUPAC name is 1-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]cyclopentan-1-amine.
| Compound Name | 1-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 103151318 |
| Molecular Formula | C12H17F3N2OS |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]cyclopentan-1-amine |
| SMILES | NC1(c2csc(CCOCC(F)(F)F)n2)CCCC1 |
| InChI | InChI=1S/C12H17F3N2OS/c13-12(14,15)8-18-6-3-10-17-9(7-19-10)11(16)4-1-2-5-11/h7H,1-6,8,16H2 |
| InChIKey | LYYTXCHBWHUSLE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|