C17H21N7O — CID 10315138
2-[4-[(5-amino-1-pyridin-2-yl-1,2,4-triazol-3-yl)amino]-N-ethylanilino]ethanol (PubChem CID 10315138) has the molecular formula C17H21N7O and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-[4-[(5-amino-1-pyridin-2-yl-1,2,4-triazol-3-yl)amino]-N-ethylanilino]ethanol.
| Compound Name | 2-[4-[(5-amino-1-pyridin-2-yl-1,2,4-triazol-3-yl)amino]-N-ethylanilino]ethanol |
|---|---|
| PubChem CID | 10315138 |
| Molecular Formula | C17H21N7O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 2-[4-[(5-amino-1-pyridin-2-yl-1,2,4-triazol-3-yl)amino]-N-ethylanilino]ethanol |
| SMILES | CCN(CCO)c1ccc(Nc2nc(N)n(-c3ccccn3)n2)cc1 |
| InChI | InChI=1S/C17H21N7O/c1-2-23(11-12-25)14-8-6-13(7-9-14)20-17-21-16(18)24(22-17)15-5-3-4-10-19-15/h3-10,25H,2,11-12H2,1H3,(H3,18,20,21,22) |
| InChIKey | GQOGZUDFHKVIMU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|