About 4-amino-2-[2-(2,2-difluoroethoxy)ethyl]pyrimidine-5-carboxamide
4-amino-2-[2-(2,2-difluoroethoxy)ethyl]pyrimidine-5-carboxamide (PubChem CID 103151381) has the molecular formula C9H12F2N4O2
and a molecular weight of 246.22 g/mol. Its IUPAC name is 4-amino-2-[2-(2,2-difluoroethoxy)ethyl]pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 4-amino-2-[2-(2,2-difluoroethoxy)ethyl]pyrimidine-5-carboxamide |
| PubChem CID | 103151381 |
| Molecular Formula | C9H12F2N4O2 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-amino-2-[2-(2,2-difluoroethoxy)ethyl]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cnc(CCOCC(F)F)nc1N |
| InChI | InChI=1S/C9H12F2N4O2/c10-6(11)4-17-2-1-7-14-3-5(9(13)16)8(12)15-7/h3,6H,1-2,4H2,(H2,13,16)(H2,12,14,15) |
| InChIKey | SCAYUBGRRMGQOE-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-[2-(2,2-difluoroethoxy)ethyl]pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-[2-(2,2-difluoroethoxy)ethyl]pyrimidine-5-carboxamide?
The IUPAC name of 4-amino-2-[2-(2,2-difluoroethoxy)ethyl]pyrimidine-5-carboxamide (CID 103151381) is 4-amino-2-[2-(2,2-difluoroethoxy)ethyl]pyrimidine-5-carboxamide.
What is the SMILES notation for 4-amino-2-[2-(2,2-difluoroethoxy)ethyl]pyrimidine-5-carboxamide?
The canonical SMILES for 4-amino-2-[2-(2,2-difluoroethoxy)ethyl]pyrimidine-5-carboxamide is NC(=O)c1cnc(CCOCC(F)F)nc1N.
What is the InChIKey of 4-amino-2-[2-(2,2-difluoroethoxy)ethyl]pyrimidine-5-carboxamide?
The InChIKey is SCAYUBGRRMGQOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2N4O2/c10-6(11)4-17-2-1-7-14-3-5(9(13)16)8(12)15-7/h3,6H,1-2,4H2,(H2,13,16)(H2,12,14,15).
What are the key properties of 4-amino-2-[2-(2,2-difluoroethoxy)ethyl]pyrimidine-5-carboxamide?
4-amino-2-[2-(2,2-difluoroethoxy)ethyl]pyrimidine-5-carboxamide has a molecular weight of 246.22 g/mol, XLogP of -0.02, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-[2-(2,2-difluoroethoxy)ethyl]pyrimidine-5-carboxamide is sourced from PubChem (CID 103151381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).