C10H13F2N3O — CID 103151407
2-[2-(2,2-difluoroethoxy)ethyl]-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine (PubChem CID 103151407) has the molecular formula C10H13F2N3O and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 103151407 |
| Molecular Formula | C10H13F2N3O |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine |
| SMILES | FC(F)COCCc1ncc2c(n1)CNC2 |
| InChI | InChI=1S/C10H13F2N3O/c11-9(12)6-16-2-1-10-14-4-7-3-13-5-8(7)15-10/h4,9,13H,1-3,5-6H2 |
| InChIKey | SDOWAZIIKCYQOP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|