C12H14F3N3O3 — CID 103151427
2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-4-carboxylic acid (PubChem CID 103151427) has the molecular formula C12H14F3N3O3 and a molecular weight of 305.26 g/mol. Its IUPAC name is 2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-4-carboxylic acid.
| Compound Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 103151427 |
| Molecular Formula | C12H14F3N3O3 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1nc(CCOCC(F)(F)F)nc2c1CCNC2 |
| InChI | InChI=1S/C12H14F3N3O3/c13-12(14,15)6-21-4-2-9-17-8-5-16-3-1-7(8)10(18-9)11(19)20/h16H,1-6H2,(H,19,20) |
| InChIKey | PNIJHDHLTRRIIF-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|