C12H15F2N3O3 — CID 103151428
2-[2-(2,2-difluoroethoxy)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-4-carboxylic acid (PubChem CID 103151428) has the molecular formula C12H15F2N3O3 and a molecular weight of 287.27 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-4-carboxylic acid.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 103151428 |
| Molecular Formula | C12H15F2N3O3 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1nc(CCOCC(F)F)nc2c1CCNC2 |
| InChI | InChI=1S/C12H15F2N3O3/c13-9(14)6-20-4-2-10-16-8-5-15-3-1-7(8)11(17-10)12(18)19/h9,15H,1-6H2,(H,18,19) |
| InChIKey | LOSWJYDUKIVOQF-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|