C13H27F3N2O — CID 103151462
1-(2,2,2-trifluoroethoxy)undecan-3-ylhydrazine (PubChem CID 103151462) has the molecular formula C13H27F3N2O and a molecular weight of 284.37 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethoxy)undecan-3-ylhydrazine.
| Compound Name | 1-(2,2,2-trifluoroethoxy)undecan-3-ylhydrazine |
|---|---|
| PubChem CID | 103151462 |
| Molecular Formula | C13H27F3N2O |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 1-(2,2,2-trifluoroethoxy)undecan-3-ylhydrazine |
| SMILES | CCCCCCCCC(CCOCC(F)(F)F)NN |
| InChI | InChI=1S/C13H27F3N2O/c1-2-3-4-5-6-7-8-12(18-17)9-10-19-11-13(14,15)16/h12,18H,2-11,17H2,1H3 |
| InChIKey | LZDJDZLPTAMFEX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|