C10H19F3N2O — CID 103151481
[5-methylidene-1-(2,2,2-trifluoroethoxy)heptan-3-yl]hydrazine (PubChem CID 103151481) has the molecular formula C10H19F3N2O and a molecular weight of 240.27 g/mol. Its IUPAC name is [5-methylidene-1-(2,2,2-trifluoroethoxy)heptan-3-yl]hydrazine.
| Compound Name | [5-methylidene-1-(2,2,2-trifluoroethoxy)heptan-3-yl]hydrazine |
|---|---|
| PubChem CID | 103151481 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [5-methylidene-1-(2,2,2-trifluoroethoxy)heptan-3-yl]hydrazine |
| SMILES | C=C(CC)CC(CCOCC(F)(F)F)NN |
| InChI | InChI=1S/C10H19F3N2O/c1-3-8(2)6-9(15-14)4-5-16-7-10(11,12)13/h9,15H,2-7,14H2,1H3 |
| InChIKey | IMIOPRFMHVWVQR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|