C13H23F3N2O2 — CID 103151509
[1-(5-oxaspiro[3.5]nonan-8-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine (PubChem CID 103151509) has the molecular formula C13H23F3N2O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is [1-(5-oxaspiro[3.5]nonan-8-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine.
| Compound Name | [1-(5-oxaspiro[3.5]nonan-8-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
|---|---|
| PubChem CID | 103151509 |
| Molecular Formula | C13H23F3N2O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | [1-(5-oxaspiro[3.5]nonan-8-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
| SMILES | NNC(CCOCC(F)(F)F)C1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C13H23F3N2O2/c14-13(15,16)9-19-6-3-11(18-17)10-2-7-20-12(8-10)4-1-5-12/h10-11,18H,1-9,17H2 |
| InChIKey | RXRFHWCDJBFPDZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|