C22H29NO2 — CID 10315157
3-[(3R,4R)-3,4-dimethyl-1-(3-phenoxypropyl)piperidin-4-yl]phenol (PubChem CID 10315157) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 3-[(3R,4R)-3,4-dimethyl-1-(3-phenoxypropyl)piperidin-4-yl]phenol.
| Compound Name | 3-[(3R,4R)-3,4-dimethyl-1-(3-phenoxypropyl)piperidin-4-yl]phenol |
|---|---|
| PubChem CID | 10315157 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 3-[(3R,4R)-3,4-dimethyl-1-(3-phenoxypropyl)piperidin-4-yl]phenol |
| SMILES | C[C@H]1CN(CCCOc2ccccc2)CC[C@@]1(C)c1cccc(O)c1 |
| InChI | InChI=1S/C22H29NO2/c1-18-17-23(13-7-15-25-21-10-4-3-5-11-21)14-12-22(18,2)19-8-6-9-20(24)16-19/h3-6,8-11,16,18,24H,7,12-15,17H2,1-2H3/t18-,22+/m0/s1 |
| InChIKey | QCNAQOMPKAJUEF-PGRDOPGGSA-N |
| XLogP | 4.46 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|