C10H21F3N2O2 — CID 103151628
[6-methoxy-4-methyl-1-(2,2,2-trifluoroethoxy)hexan-3-yl]hydrazine (PubChem CID 103151628) has the molecular formula C10H21F3N2O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is [6-methoxy-4-methyl-1-(2,2,2-trifluoroethoxy)hexan-3-yl]hydrazine.
| Compound Name | [6-methoxy-4-methyl-1-(2,2,2-trifluoroethoxy)hexan-3-yl]hydrazine |
|---|---|
| PubChem CID | 103151628 |
| Molecular Formula | C10H21F3N2O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | [6-methoxy-4-methyl-1-(2,2,2-trifluoroethoxy)hexan-3-yl]hydrazine |
| SMILES | COCCC(C)C(CCOCC(F)(F)F)NN |
| InChI | InChI=1S/C10H21F3N2O2/c1-8(3-5-16-2)9(15-14)4-6-17-7-10(11,12)13/h8-9,15H,3-7,14H2,1-2H3 |
| InChIKey | YWPTZVKGFBBFBS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|