C8H14F6N2O — CID 103151649
[6,6,6-trifluoro-1-(2,2,2-trifluoroethoxy)hexan-3-yl]hydrazine (PubChem CID 103151649) has the molecular formula C8H14F6N2O and a molecular weight of 268.20 g/mol. Its IUPAC name is [6,6,6-trifluoro-1-(2,2,2-trifluoroethoxy)hexan-3-yl]hydrazine.
| Compound Name | [6,6,6-trifluoro-1-(2,2,2-trifluoroethoxy)hexan-3-yl]hydrazine |
|---|---|
| PubChem CID | 103151649 |
| Molecular Formula | C8H14F6N2O |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | [6,6,6-trifluoro-1-(2,2,2-trifluoroethoxy)hexan-3-yl]hydrazine |
| SMILES | NNC(CCOCC(F)(F)F)CCC(F)(F)F |
| InChI | InChI=1S/C8H14F6N2O/c9-7(10,11)3-1-6(16-15)2-4-17-5-8(12,13)14/h6,16H,1-5,15H2 |
| InChIKey | IMTYKIVQXIKCKE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|