C11H23F3N2O2 — CID 103151680
[6-methoxy-6-methyl-1-(2,2,2-trifluoroethoxy)heptan-3-yl]hydrazine (PubChem CID 103151680) has the molecular formula C11H23F3N2O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is [6-methoxy-6-methyl-1-(2,2,2-trifluoroethoxy)heptan-3-yl]hydrazine.
| Compound Name | [6-methoxy-6-methyl-1-(2,2,2-trifluoroethoxy)heptan-3-yl]hydrazine |
|---|---|
| PubChem CID | 103151680 |
| Molecular Formula | C11H23F3N2O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | [6-methoxy-6-methyl-1-(2,2,2-trifluoroethoxy)heptan-3-yl]hydrazine |
| SMILES | COC(C)(C)CCC(CCOCC(F)(F)F)NN |
| InChI | InChI=1S/C11H23F3N2O2/c1-10(2,17-3)6-4-9(16-15)5-7-18-8-11(12,13)14/h9,16H,4-8,15H2,1-3H3 |
| InChIKey | OQNCEAMZHSDKAA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|