About [1-propan-2-yloxy-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine
[1-propan-2-yloxy-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine (PubChem CID 103151741) has the molecular formula C9H19F3N2O2
and a molecular weight of 244.26 g/mol. Its IUPAC name is [1-propan-2-yloxy-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine.
Molecular Properties
| Compound Name | [1-propan-2-yloxy-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine |
| PubChem CID | 103151741 |
| Molecular Formula | C9H19F3N2O2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | [1-propan-2-yloxy-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine |
| SMILES | CC(C)OCC(CCOCC(F)(F)F)NN |
| InChI | InChI=1S/C9H19F3N2O2/c1-7(2)16-5-8(14-13)3-4-15-6-9(10,11)12/h7-8,14H,3-6,13H2,1-2H3 |
| InChIKey | JTTJXQHYKPAZLK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-propan-2-yloxy-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-propan-2-yloxy-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine?
The IUPAC name of [1-propan-2-yloxy-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine (CID 103151741) is [1-propan-2-yloxy-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine.
What is the SMILES notation for [1-propan-2-yloxy-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine?
The canonical SMILES for [1-propan-2-yloxy-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine is CC(C)OCC(CCOCC(F)(F)F)NN.
What is the InChIKey of [1-propan-2-yloxy-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine?
The InChIKey is JTTJXQHYKPAZLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F3N2O2/c1-7(2)16-5-8(14-13)3-4-15-6-9(10,11)12/h7-8,14H,3-6,13H2,1-2H3.
What are the key properties of [1-propan-2-yloxy-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine?
[1-propan-2-yloxy-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine has a molecular weight of 244.26 g/mol, XLogP of 1.21, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-propan-2-yloxy-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine is sourced from PubChem (CID 103151741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).