C10H22F2N2O — CID 103151782
1-(2,2-difluoroethoxy)octan-3-ylhydrazine (PubChem CID 103151782) has the molecular formula C10H22F2N2O and a molecular weight of 224.29 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)octan-3-ylhydrazine.
| Compound Name | 1-(2,2-difluoroethoxy)octan-3-ylhydrazine |
|---|---|
| PubChem CID | 103151782 |
| Molecular Formula | C10H22F2N2O |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 1-(2,2-difluoroethoxy)octan-3-ylhydrazine |
| SMILES | CCCCCC(CCOCC(F)F)NN |
| InChI | InChI=1S/C10H22F2N2O/c1-2-3-4-5-9(14-13)6-7-15-8-10(11)12/h9-10,14H,2-8,13H2,1H3 |
| InChIKey | PFOQWFAGNBJETK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|