About 1-(2,2-difluoroethoxy)hex-5-en-3-ylhydrazine
1-(2,2-difluoroethoxy)hex-5-en-3-ylhydrazine (PubChem CID 103151793) has the molecular formula C8H16F2N2O
and a molecular weight of 194.22 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)hex-5-en-3-ylhydrazine.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethoxy)hex-5-en-3-ylhydrazine |
| PubChem CID | 103151793 |
| Molecular Formula | C8H16F2N2O |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 1-(2,2-difluoroethoxy)hex-5-en-3-ylhydrazine |
| SMILES | C=CCC(CCOCC(F)F)NN |
| InChI | InChI=1S/C8H16F2N2O/c1-2-3-7(12-11)4-5-13-6-8(9)10/h2,7-8,12H,1,3-6,11H2 |
| InChIKey | LQSGPMUBDJOUBD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-difluoroethoxy)hex-5-en-3-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethoxy)hex-5-en-3-ylhydrazine?
The IUPAC name of 1-(2,2-difluoroethoxy)hex-5-en-3-ylhydrazine (CID 103151793) is 1-(2,2-difluoroethoxy)hex-5-en-3-ylhydrazine.
What is the SMILES notation for 1-(2,2-difluoroethoxy)hex-5-en-3-ylhydrazine?
The canonical SMILES for 1-(2,2-difluoroethoxy)hex-5-en-3-ylhydrazine is C=CCC(CCOCC(F)F)NN.
What is the InChIKey of 1-(2,2-difluoroethoxy)hex-5-en-3-ylhydrazine?
The InChIKey is LQSGPMUBDJOUBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F2N2O/c1-2-3-7(12-11)4-5-13-6-8(9)10/h2,7-8,12H,1,3-6,11H2.
What are the key properties of 1-(2,2-difluoroethoxy)hex-5-en-3-ylhydrazine?
1-(2,2-difluoroethoxy)hex-5-en-3-ylhydrazine has a molecular weight of 194.22 g/mol, XLogP of 1.07, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethoxy)hex-5-en-3-ylhydrazine is sourced from PubChem (CID 103151793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).