About [4-(2,2-difluoroethoxy)-1-ethoxybutan-2-yl]hydrazine
[4-(2,2-difluoroethoxy)-1-ethoxybutan-2-yl]hydrazine (PubChem CID 103151998) has the molecular formula C8H18F2N2O2
and a molecular weight of 212.24 g/mol. Its IUPAC name is [4-(2,2-difluoroethoxy)-1-ethoxybutan-2-yl]hydrazine.
Molecular Properties
| Compound Name | [4-(2,2-difluoroethoxy)-1-ethoxybutan-2-yl]hydrazine |
| PubChem CID | 103151998 |
| Molecular Formula | C8H18F2N2O2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | [4-(2,2-difluoroethoxy)-1-ethoxybutan-2-yl]hydrazine |
| SMILES | CCOCC(CCOCC(F)F)NN |
| InChI | InChI=1S/C8H18F2N2O2/c1-2-13-5-7(12-11)3-4-14-6-8(9)10/h7-8,12H,2-6,11H2,1H3 |
| InChIKey | KCKRJGWBQOCSMR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,2-difluoroethoxy)-1-ethoxybutan-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,2-difluoroethoxy)-1-ethoxybutan-2-yl]hydrazine?
The IUPAC name of [4-(2,2-difluoroethoxy)-1-ethoxybutan-2-yl]hydrazine (CID 103151998) is [4-(2,2-difluoroethoxy)-1-ethoxybutan-2-yl]hydrazine.
What is the SMILES notation for [4-(2,2-difluoroethoxy)-1-ethoxybutan-2-yl]hydrazine?
The canonical SMILES for [4-(2,2-difluoroethoxy)-1-ethoxybutan-2-yl]hydrazine is CCOCC(CCOCC(F)F)NN.
What is the InChIKey of [4-(2,2-difluoroethoxy)-1-ethoxybutan-2-yl]hydrazine?
The InChIKey is KCKRJGWBQOCSMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18F2N2O2/c1-2-13-5-7(12-11)3-4-14-6-8(9)10/h7-8,12H,2-6,11H2,1H3.
What are the key properties of [4-(2,2-difluoroethoxy)-1-ethoxybutan-2-yl]hydrazine?
[4-(2,2-difluoroethoxy)-1-ethoxybutan-2-yl]hydrazine has a molecular weight of 212.24 g/mol, XLogP of 0.53, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,2-difluoroethoxy)-1-ethoxybutan-2-yl]hydrazine is sourced from PubChem (CID 103151998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).