C10H18F2N2O2 — CID 103152014
[3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)propyl]hydrazine (PubChem CID 103152014) has the molecular formula C10H18F2N2O2 and a molecular weight of 236.26 g/mol. Its IUPAC name is [3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)propyl]hydrazine.
| Compound Name | [3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 103152014 |
| Molecular Formula | C10H18F2N2O2 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | [3-(2,2-difluoroethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)propyl]hydrazine |
| SMILES | NNC(CCOCC(F)F)C1=CCCCO1 |
| InChI | InChI=1S/C10H18F2N2O2/c11-10(12)7-15-6-4-8(14-13)9-3-1-2-5-16-9/h3,8,10,14H,1-2,4-7,13H2 |
| InChIKey | MATOWKDOKDHNOL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|