About [1-(2,2-difluoroethoxy)-6-ethylsulfonylhexan-3-yl]hydrazine
[1-(2,2-difluoroethoxy)-6-ethylsulfonylhexan-3-yl]hydrazine (PubChem CID 103152082) has the molecular formula C10H22F2N2O3S
and a molecular weight of 288.36 g/mol. Its IUPAC name is [1-(2,2-difluoroethoxy)-6-ethylsulfonylhexan-3-yl]hydrazine.
Molecular Properties
| Compound Name | [1-(2,2-difluoroethoxy)-6-ethylsulfonylhexan-3-yl]hydrazine |
| PubChem CID | 103152082 |
| Molecular Formula | C10H22F2N2O3S |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | [1-(2,2-difluoroethoxy)-6-ethylsulfonylhexan-3-yl]hydrazine |
| SMILES | CCS(=O)(=O)CCCC(CCOCC(F)F)NN |
| InChI | InChI=1S/C10H22F2N2O3S/c1-2-18(15,16)7-3-4-9(14-13)5-6-17-8-10(11)12/h9-10,14H,2-8,13H2,1H3 |
| InChIKey | GNRLGRZVOLIPOK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,2-difluoroethoxy)-6-ethylsulfonylhexan-3-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2-difluoroethoxy)-6-ethylsulfonylhexan-3-yl]hydrazine?
The IUPAC name of [1-(2,2-difluoroethoxy)-6-ethylsulfonylhexan-3-yl]hydrazine (CID 103152082) is [1-(2,2-difluoroethoxy)-6-ethylsulfonylhexan-3-yl]hydrazine.
What is the SMILES notation for [1-(2,2-difluoroethoxy)-6-ethylsulfonylhexan-3-yl]hydrazine?
The canonical SMILES for [1-(2,2-difluoroethoxy)-6-ethylsulfonylhexan-3-yl]hydrazine is CCS(=O)(=O)CCCC(CCOCC(F)F)NN.
What is the InChIKey of [1-(2,2-difluoroethoxy)-6-ethylsulfonylhexan-3-yl]hydrazine?
The InChIKey is GNRLGRZVOLIPOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22F2N2O3S/c1-2-18(15,16)7-3-4-9(14-13)5-6-17-8-10(11)12/h9-10,14H,2-8,13H2,1H3.
What are the key properties of [1-(2,2-difluoroethoxy)-6-ethylsulfonylhexan-3-yl]hydrazine?
[1-(2,2-difluoroethoxy)-6-ethylsulfonylhexan-3-yl]hydrazine has a molecular weight of 288.36 g/mol, XLogP of 0.70, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2-difluoroethoxy)-6-ethylsulfonylhexan-3-yl]hydrazine is sourced from PubChem (CID 103152082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).