About [3-(2,2-difluoroethoxy)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)propyl]hydrazine
[3-(2,2-difluoroethoxy)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)propyl]hydrazine (PubChem CID 103152084) has the molecular formula C14H26F2N2O3
and a molecular weight of 308.37 g/mol. Its IUPAC name is [3-(2,2-difluoroethoxy)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)propyl]hydrazine.
Molecular Properties
| Compound Name | [3-(2,2-difluoroethoxy)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)propyl]hydrazine |
| PubChem CID | 103152084 |
| Molecular Formula | C14H26F2N2O3 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | [3-(2,2-difluoroethoxy)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)propyl]hydrazine |
| SMILES | NNC(CCOCC(F)F)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C14H26F2N2O3/c15-13(16)10-20-5-2-12(18-17)11-1-6-21-14(9-11)3-7-19-8-4-14/h11-13,18H,1-10,17H2 |
| InChIKey | UEDWFLPHHXOYCV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(2,2-difluoroethoxy)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)propyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,2-difluoroethoxy)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)propyl]hydrazine?
The IUPAC name of [3-(2,2-difluoroethoxy)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)propyl]hydrazine (CID 103152084) is [3-(2,2-difluoroethoxy)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)propyl]hydrazine.
What is the SMILES notation for [3-(2,2-difluoroethoxy)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)propyl]hydrazine?
The canonical SMILES for [3-(2,2-difluoroethoxy)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)propyl]hydrazine is NNC(CCOCC(F)F)C1CCOC2(CCOCC2)C1.
What is the InChIKey of [3-(2,2-difluoroethoxy)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)propyl]hydrazine?
The InChIKey is UEDWFLPHHXOYCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26F2N2O3/c15-13(16)10-20-5-2-12(18-17)11-1-6-21-14(9-11)3-7-19-8-4-14/h11-13,18H,1-10,17H2.
What are the key properties of [3-(2,2-difluoroethoxy)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)propyl]hydrazine?
[3-(2,2-difluoroethoxy)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)propyl]hydrazine has a molecular weight of 308.37 g/mol, XLogP of 1.47, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,2-difluoroethoxy)-1-(1,9-dioxaspiro[5.5]undecan-4-yl)propyl]hydrazine is sourced from PubChem (CID 103152084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).