About [(2S,4R)-5-(9-borabicyclo[3.3.1]nonan-9-yl)-4-methylpentan-2-yl]-dimethyl-phenylsilane
[(2S,4R)-5-(9-borabicyclo[3.3.1]nonan-9-yl)-4-methylpentan-2-yl]-dimethyl-phenylsilane (PubChem CID 10315212) has the molecular formula C22H37BSi
and a molecular weight of 340.44 g/mol. Its IUPAC name is [(2S,4R)-5-(9-borabicyclo[3.3.1]nonan-9-yl)-4-methylpentan-2-yl]-dimethyl-phenylsilane.
Molecular Properties
| Compound Name | [(2S,4R)-5-(9-borabicyclo[3.3.1]nonan-9-yl)-4-methylpentan-2-yl]-dimethyl-phenylsilane |
| PubChem CID | 10315212 |
| Molecular Formula | C22H37BSi |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | [(2S,4R)-5-(9-borabicyclo[3.3.1]nonan-9-yl)-4-methylpentan-2-yl]-dimethyl-phenylsilane |
| SMILES | C[C@H](CB1C2CCCC1CCC2)C[C@H](C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C22H37BSi/c1-18(17-23-20-10-8-11-21(23)13-9-12-20)16-19(2)24(3,4)22-14-6-5-7-15-22/h5-7,14-15,18-21H,8-13,16-17H2,1-4H3/t18-,19-,20?,21?/m0/s1 |
| InChIKey | CKLDTIKSURIVDD-IKJYFWGWSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2S,4R)-5-(9-borabicyclo[3.3.1]nonan-9-yl)-4-methylpentan-2-yl]-dimethyl-phenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4R)-5-(9-borabicyclo[3.3.1]nonan-9-yl)-4-methylpentan-2-yl]-dimethyl-phenylsilane?
The IUPAC name of [(2S,4R)-5-(9-borabicyclo[3.3.1]nonan-9-yl)-4-methylpentan-2-yl]-dimethyl-phenylsilane (CID 10315212) is [(2S,4R)-5-(9-borabicyclo[3.3.1]nonan-9-yl)-4-methylpentan-2-yl]-dimethyl-phenylsilane.
What is the SMILES notation for [(2S,4R)-5-(9-borabicyclo[3.3.1]nonan-9-yl)-4-methylpentan-2-yl]-dimethyl-phenylsilane?
The canonical SMILES for [(2S,4R)-5-(9-borabicyclo[3.3.1]nonan-9-yl)-4-methylpentan-2-yl]-dimethyl-phenylsilane is C[C@H](CB1C2CCCC1CCC2)C[C@H](C)[Si](C)(C)c1ccccc1.
What is the InChIKey of [(2S,4R)-5-(9-borabicyclo[3.3.1]nonan-9-yl)-4-methylpentan-2-yl]-dimethyl-phenylsilane?
The InChIKey is CKLDTIKSURIVDD-IKJYFWGWSA-N. The full InChI is InChI=1S/C22H37BSi/c1-18(17-23-20-10-8-11-21(23)13-9-12-20)16-19(2)24(3,4)22-14-6-5-7-15-22/h5-7,14-15,18-21H,8-13,16-17H2,1-4H3/t18-,19-,20?,21?/m0/s1.
What are the key properties of [(2S,4R)-5-(9-borabicyclo[3.3.1]nonan-9-yl)-4-methylpentan-2-yl]-dimethyl-phenylsilane?
[(2S,4R)-5-(9-borabicyclo[3.3.1]nonan-9-yl)-4-methylpentan-2-yl]-dimethyl-phenylsilane has a molecular weight of 340.44 g/mol, XLogP of 6.62, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4R)-5-(9-borabicyclo[3.3.1]nonan-9-yl)-4-methylpentan-2-yl]-dimethyl-phenylsilane is sourced from PubChem (CID 10315212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).