C22H28O3 — CID 10315219
[(1'S,2S,2'R,5'S,6'R,7'R)-2'-methyl-5'-propan-2-ylspiro[oxirane-2,8'-tricyclo[5.3.0.02,6]decane]-1'-yl] benzoate (PubChem CID 10315219) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is [(1'S,2S,2'R,5'S,6'R,7'R)-2'-methyl-5'-propan-2-ylspiro[oxirane-2,8'-tricyclo[5.3.0.02,6]decane]-1'-yl] benzoate.
| Compound Name | [(1'S,2S,2'R,5'S,6'R,7'R)-2'-methyl-5'-propan-2-ylspiro[oxirane-2,8'-tricyclo[5.3.0.02,6]decane]-1'-yl] benzoate |
|---|---|
| PubChem CID | 10315219 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | [(1'S,2S,2'R,5'S,6'R,7'R)-2'-methyl-5'-propan-2-ylspiro[oxirane-2,8'-tricyclo[5.3.0.02,6]decane]-1'-yl] benzoate |
| SMILES | CC(C)[C@@H]1CC[C@]2(C)[C@H]1[C@H]1[C@@]3(CC[C@]12OC(=O)c1ccccc1)CO3 |
| InChI | InChI=1S/C22H28O3/c1-14(2)16-9-10-20(3)17(16)18-21(13-24-21)11-12-22(18,20)25-19(23)15-7-5-4-6-8-15/h4-8,14,16-18H,9-13H2,1-3H3/t16-,17+,18-,20+,21+,22-/m0/s1 |
| InChIKey | CYIXMYYUXQSZJI-DZKVBSAQSA-N |
| XLogP | 4.46 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|