C19H36O3Si — CID 10315232
(1R)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(1R,3S)-3-ethenyl-2,2-dimethylcyclopropyl]-1-hydroxyhexan-3-one (PubChem CID 10315232) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is (1R)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(1R,3S)-3-ethenyl-2,2-dimethylcyclopropyl]-1-hydroxyhexan-3-one.
| Compound Name | (1R)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(1R,3S)-3-ethenyl-2,2-dimethylcyclopropyl]-1-hydroxyhexan-3-one |
|---|---|
| PubChem CID | 10315232 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (1R)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(1R,3S)-3-ethenyl-2,2-dimethylcyclopropyl]-1-hydroxyhexan-3-one |
| SMILES | C=C[C@H]1[C@@H]([C@H](O)CC(=O)CCCO[Si](C)(C)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C19H36O3Si/c1-9-15-17(19(15,5)6)16(21)13-14(20)11-10-12-22-23(7,8)18(2,3)4/h9,15-17,21H,1,10-13H2,2-8H3/t15-,16+,17-/m0/s1 |
| InChIKey | WACKDWRLTYIFSM-BBWFWOEESA-N |
| XLogP | 4.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|