C12H13BrClNO4 — CID 103153043
4-[(4-bromo-3-chlorobenzoyl)amino]-3-methoxybutanoic acid (PubChem CID 103153043) has the molecular formula C12H13BrClNO4 and a molecular weight of 350.60 g/mol. Its IUPAC name is 4-[(4-bromo-3-chlorobenzoyl)amino]-3-methoxybutanoic acid.
| Compound Name | 4-[(4-bromo-3-chlorobenzoyl)amino]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 103153043 |
| Molecular Formula | C12H13BrClNO4 |
| Molecular Weight | 350.60 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 4-[(4-bromo-3-chlorobenzoyl)amino]-3-methoxybutanoic acid |
| SMILES | COC(CNC(=O)c1ccc(Br)c(Cl)c1)CC(=O)O |
| InChI | InChI=1S/C12H13BrClNO4/c1-19-8(5-11(16)17)6-15-12(18)7-2-3-9(13)10(14)4-7/h2-4,8H,5-6H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | QYWVEOJCGJXKFH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.60 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |