C16H17NO4 — CID 103153230
3-methoxy-4-(naphthalene-1-carbonylamino)butanoic acid (PubChem CID 103153230) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is 3-methoxy-4-(naphthalene-1-carbonylamino)butanoic acid.
| Compound Name | 3-methoxy-4-(naphthalene-1-carbonylamino)butanoic acid |
|---|---|
| PubChem CID | 103153230 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 3-methoxy-4-(naphthalene-1-carbonylamino)butanoic acid |
| SMILES | COC(CNC(=O)c1cccc2ccccc12)CC(=O)O |
| InChI | InChI=1S/C16H17NO4/c1-21-12(9-15(18)19)10-17-16(20)14-8-4-6-11-5-2-3-7-13(11)14/h2-8,12H,9-10H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | ZIDZPZDBPQFMFT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |