About 4-amino-N,N-diethyl-3-methoxybutanamide
4-amino-N,N-diethyl-3-methoxybutanamide (PubChem CID 103154039) has the molecular formula C9H20N2O2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 4-amino-N,N-diethyl-3-methoxybutanamide.
Molecular Properties
| Compound Name | 4-amino-N,N-diethyl-3-methoxybutanamide |
| PubChem CID | 103154039 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 4-amino-N,N-diethyl-3-methoxybutanamide |
| SMILES | CCN(CC)C(=O)CC(CN)OC |
| InChI | InChI=1S/C9H20N2O2/c1-4-11(5-2)9(12)6-8(7-10)13-3/h8H,4-7,10H2,1-3H3 |
| InChIKey | NTQONZGEGDZRLT-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-N,N-diethyl-3-methoxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N,N-diethyl-3-methoxybutanamide?
The IUPAC name of 4-amino-N,N-diethyl-3-methoxybutanamide (CID 103154039) is 4-amino-N,N-diethyl-3-methoxybutanamide.
What is the SMILES notation for 4-amino-N,N-diethyl-3-methoxybutanamide?
The canonical SMILES for 4-amino-N,N-diethyl-3-methoxybutanamide is CCN(CC)C(=O)CC(CN)OC.
What is the InChIKey of 4-amino-N,N-diethyl-3-methoxybutanamide?
The InChIKey is NTQONZGEGDZRLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O2/c1-4-11(5-2)9(12)6-8(7-10)13-3/h8H,4-7,10H2,1-3H3.
What are the key properties of 4-amino-N,N-diethyl-3-methoxybutanamide?
4-amino-N,N-diethyl-3-methoxybutanamide has a molecular weight of 188.27 g/mol, XLogP of 0.22, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N,N-diethyl-3-methoxybutanamide is sourced from PubChem (CID 103154039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).