About 4-amino-3-methoxy-N,N-dipropylbutanamide
4-amino-3-methoxy-N,N-dipropylbutanamide (PubChem CID 103154067) has the molecular formula C11H24N2O2
and a molecular weight of 216.32 g/mol. Its IUPAC name is 4-amino-3-methoxy-N,N-dipropylbutanamide.
Molecular Properties
| Compound Name | 4-amino-3-methoxy-N,N-dipropylbutanamide |
| PubChem CID | 103154067 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 4-amino-3-methoxy-N,N-dipropylbutanamide |
| SMILES | CCCN(CCC)C(=O)CC(CN)OC |
| InChI | InChI=1S/C11H24N2O2/c1-4-6-13(7-5-2)11(14)8-10(9-12)15-3/h10H,4-9,12H2,1-3H3 |
| InChIKey | MZCOBNUNAPIGEA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-3-methoxy-N,N-dipropylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-methoxy-N,N-dipropylbutanamide?
The IUPAC name of 4-amino-3-methoxy-N,N-dipropylbutanamide (CID 103154067) is 4-amino-3-methoxy-N,N-dipropylbutanamide.
What is the SMILES notation for 4-amino-3-methoxy-N,N-dipropylbutanamide?
The canonical SMILES for 4-amino-3-methoxy-N,N-dipropylbutanamide is CCCN(CCC)C(=O)CC(CN)OC.
What is the InChIKey of 4-amino-3-methoxy-N,N-dipropylbutanamide?
The InChIKey is MZCOBNUNAPIGEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O2/c1-4-6-13(7-5-2)11(14)8-10(9-12)15-3/h10H,4-9,12H2,1-3H3.
What are the key properties of 4-amino-3-methoxy-N,N-dipropylbutanamide?
4-amino-3-methoxy-N,N-dipropylbutanamide has a molecular weight of 216.32 g/mol, XLogP of 1.00, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-methoxy-N,N-dipropylbutanamide is sourced from PubChem (CID 103154067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).