C20H24O5 — CID 10315467
(1S,8R,9R,10R,11R,12R)-11-hydroxy-9,10,12-trimethyl-9-[(2Z)-2-(2-oxofuran-3-ylidene)ethyl]-2-oxatricyclo[6.3.1.04,12]dodec-4-en-3-one (PubChem CID 10315467) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (1S,8R,9R,10R,11R,12R)-11-hydroxy-9,10,12-trimethyl-9-[(2Z)-2-(2-oxofuran-3-ylidene)ethyl]-2-oxatricyclo[6.3.1.04,12]dodec-4-en-3-one.
| Compound Name | (1S,8R,9R,10R,11R,12R)-11-hydroxy-9,10,12-trimethyl-9-[(2Z)-2-(2-oxofuran-3-ylidene)ethyl]-2-oxatricyclo[6.3.1.04,12]dodec-4-en-3-one |
|---|---|
| PubChem CID | 10315467 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (1S,8R,9R,10R,11R,12R)-11-hydroxy-9,10,12-trimethyl-9-[(2Z)-2-(2-oxofuran-3-ylidene)ethyl]-2-oxatricyclo[6.3.1.04,12]dodec-4-en-3-one |
| SMILES | C[C@H]1[C@@H](O)[C@H]2OC(=O)C3=CCC[C@H]([C@@]1(C)C/C=C1/C=COC1=O)[C@]32C |
| InChI | InChI=1S/C20H24O5/c1-11-15(21)16-20(3)13(18(23)25-16)5-4-6-14(20)19(11,2)9-7-12-8-10-24-17(12)22/h5,7-8,10-11,14-16,21H,4,6,9H2,1-3H3/b12-7-/t11-,14+,15+,16+,19-,20-/m0/s1 |
| InChIKey | RSQXBETWRJNQJN-YLBZHWJGSA-N |
| XLogP | 2.66 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|