C21H28O4 — CID 10315485
ethyl 2-[(11R,17S)-3,17-dihydroxy-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-11-yl]acetate (PubChem CID 10315485) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is ethyl 2-[(11R,17S)-3,17-dihydroxy-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-11-yl]acetate.
| Compound Name | ethyl 2-[(11R,17S)-3,17-dihydroxy-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-11-yl]acetate |
|---|---|
| PubChem CID | 10315485 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | ethyl 2-[(11R,17S)-3,17-dihydroxy-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-11-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CC2C(CC[C@@H]2O)C2CCc3cc(O)ccc3C21 |
| InChI | InChI=1S/C21H28O4/c1-2-25-20(24)11-13-10-18-16(7-8-19(18)23)17-5-3-12-9-14(22)4-6-15(12)21(13)17/h4,6,9,13,16-19,21-23H,2-3,5,7-8,10-11H2,1H3/t13-,16?,17?,18?,19+,21?/m1/s1 |
| InChIKey | CKVALZMEUAMGSH-IBXDNAIQSA-N |
| XLogP | 3.40 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |