C12H24N2O2 — CID 103155888
4-amino-3-methoxy-1-(4-methylazepan-1-yl)butan-1-one (PubChem CID 103155888) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 4-amino-3-methoxy-1-(4-methylazepan-1-yl)butan-1-one.
| Compound Name | 4-amino-3-methoxy-1-(4-methylazepan-1-yl)butan-1-one |
|---|---|
| PubChem CID | 103155888 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 4-amino-3-methoxy-1-(4-methylazepan-1-yl)butan-1-one |
| SMILES | COC(CN)CC(=O)N1CCCC(C)CC1 |
| InChI | InChI=1S/C12H24N2O2/c1-10-4-3-6-14(7-5-10)12(15)8-11(9-13)16-2/h10-11H,3-9,13H2,1-2H3 |
| InChIKey | YNKHCHUIYSLTCC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |