C20H30O4 — CID 10315594
(Z)-2-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]but-2-enedioic acid (PubChem CID 10315594) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (Z)-2-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]but-2-enedioic acid.
| Compound Name | (Z)-2-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 10315594 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (Z)-2-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]but-2-enedioic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C/C(C(=O)O)=C(\C)C(=O)O |
| InChI | InChI=1S/C20H30O4/c1-14(2)8-6-9-15(3)10-7-11-16(4)12-13-18(20(23)24)17(5)19(21)22/h8,10,12H,6-7,9,11,13H2,1-5H3,(H,21,22)(H,23,24)/b15-10+,16-12+,18-17- |
| InChIKey | WYCNRYCNFKZZEF-PYBNABTASA-N |
| XLogP | 5.28 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|