About 4-amino-N-(2,2-difluoroethyl)-3-methoxy-N-methylbutanamide
4-amino-N-(2,2-difluoroethyl)-3-methoxy-N-methylbutanamide (PubChem CID 103156737) has the molecular formula C8H16F2N2O2
and a molecular weight of 210.22 g/mol. Its IUPAC name is 4-amino-N-(2,2-difluoroethyl)-3-methoxy-N-methylbutanamide.
Molecular Properties
| Compound Name | 4-amino-N-(2,2-difluoroethyl)-3-methoxy-N-methylbutanamide |
| PubChem CID | 103156737 |
| Molecular Formula | C8H16F2N2O2 |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 4-amino-N-(2,2-difluoroethyl)-3-methoxy-N-methylbutanamide |
| SMILES | COC(CN)CC(=O)N(C)CC(F)F |
| InChI | InChI=1S/C8H16F2N2O2/c1-12(5-7(9)10)8(13)3-6(4-11)14-2/h6-7H,3-5,11H2,1-2H3 |
| InChIKey | VLSYSAOMJBJJOE-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-N-(2,2-difluoroethyl)-3-methoxy-N-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(2,2-difluoroethyl)-3-methoxy-N-methylbutanamide?
The IUPAC name of 4-amino-N-(2,2-difluoroethyl)-3-methoxy-N-methylbutanamide (CID 103156737) is 4-amino-N-(2,2-difluoroethyl)-3-methoxy-N-methylbutanamide.
What is the SMILES notation for 4-amino-N-(2,2-difluoroethyl)-3-methoxy-N-methylbutanamide?
The canonical SMILES for 4-amino-N-(2,2-difluoroethyl)-3-methoxy-N-methylbutanamide is COC(CN)CC(=O)N(C)CC(F)F.
What is the InChIKey of 4-amino-N-(2,2-difluoroethyl)-3-methoxy-N-methylbutanamide?
The InChIKey is VLSYSAOMJBJJOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F2N2O2/c1-12(5-7(9)10)8(13)3-6(4-11)14-2/h6-7H,3-5,11H2,1-2H3.
What are the key properties of 4-amino-N-(2,2-difluoroethyl)-3-methoxy-N-methylbutanamide?
4-amino-N-(2,2-difluoroethyl)-3-methoxy-N-methylbutanamide has a molecular weight of 210.22 g/mol, XLogP of 0.07, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(2,2-difluoroethyl)-3-methoxy-N-methylbutanamide is sourced from PubChem (CID 103156737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).