C23H25NO2 — CID 10315687
4-[2-(4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinolin-7-yl)ethynyl]benzoic acid (PubChem CID 10315687) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 4-[2-(4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinolin-7-yl)ethynyl]benzoic acid.
| Compound Name | 4-[2-(4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinolin-7-yl)ethynyl]benzoic acid |
|---|---|
| PubChem CID | 10315687 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 4-[2-(4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinolin-7-yl)ethynyl]benzoic acid |
| SMILES | CC(C)N1CCC(C)(C)c2ccc(C#Cc3ccc(C(=O)O)cc3)cc21 |
| InChI | InChI=1S/C23H25NO2/c1-16(2)24-14-13-23(3,4)20-12-9-18(15-21(20)24)6-5-17-7-10-19(11-8-17)22(25)26/h7-12,15-16H,13-14H2,1-4H3,(H,25,26) |
| InChIKey | PELTVBAJLHDYJZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|