C17H25NO — CID 103157324
1-cyclopentyl-3-(2,3-dihydro-1H-inden-1-ylamino)propan-2-ol (PubChem CID 103157324) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2,3-dihydro-1H-inden-1-ylamino)propan-2-ol.
| Compound Name | 1-cyclopentyl-3-(2,3-dihydro-1H-inden-1-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 103157324 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 1-cyclopentyl-3-(2,3-dihydro-1H-inden-1-ylamino)propan-2-ol |
| SMILES | OC(CNC1CCc2ccccc21)CC1CCCC1 |
| InChI | InChI=1S/C17H25NO/c19-15(11-13-5-1-2-6-13)12-18-17-10-9-14-7-3-4-8-16(14)17/h3-4,7-8,13,15,17-19H,1-2,5-6,9-12H2 |
| InChIKey | PBNRMZUYOBLFSS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |