C8H9F5N4O3 — CID 103160356
3-methoxy-4-[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-1-yl]butanoic acid (PubChem CID 103160356) has the molecular formula C8H9F5N4O3 and a molecular weight of 304.18 g/mol. Its IUPAC name is 3-methoxy-4-[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-1-yl]butanoic acid.
| Compound Name | 3-methoxy-4-[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 103160356 |
| Molecular Formula | C8H9F5N4O3 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-methoxy-4-[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-1-yl]butanoic acid |
| SMILES | COC(CC(=O)O)Cn1nnnc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F5N4O3/c1-20-4(2-5(18)19)3-17-6(14-15-16-17)7(9,10)8(11,12)13/h4H,2-3H2,1H3,(H,18,19) |
| InChIKey | ANUUWARROPGNGC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|