About 3-methoxy-4-[5-(2,2,2-trifluoroethyl)tetrazol-1-yl]butanoic acid
3-methoxy-4-[5-(2,2,2-trifluoroethyl)tetrazol-1-yl]butanoic acid (PubChem CID 103160396) has the molecular formula C8H11F3N4O3
and a molecular weight of 268.19 g/mol. Its IUPAC name is 3-methoxy-4-[5-(2,2,2-trifluoroethyl)tetrazol-1-yl]butanoic acid.
Molecular Properties
| Compound Name | 3-methoxy-4-[5-(2,2,2-trifluoroethyl)tetrazol-1-yl]butanoic acid |
| PubChem CID | 103160396 |
| Molecular Formula | C8H11F3N4O3 |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 3-methoxy-4-[5-(2,2,2-trifluoroethyl)tetrazol-1-yl]butanoic acid |
| SMILES | COC(CC(=O)O)Cn1nnnc1CC(F)(F)F |
| InChI | InChI=1S/C8H11F3N4O3/c1-18-5(2-7(16)17)4-15-6(12-13-14-15)3-8(9,10)11/h5H,2-4H2,1H3,(H,16,17) |
| InChIKey | YVXJBOKQDDNZDY-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-methoxy-4-[5-(2,2,2-trifluoroethyl)tetrazol-1-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-4-[5-(2,2,2-trifluoroethyl)tetrazol-1-yl]butanoic acid?
The IUPAC name of 3-methoxy-4-[5-(2,2,2-trifluoroethyl)tetrazol-1-yl]butanoic acid (CID 103160396) is 3-methoxy-4-[5-(2,2,2-trifluoroethyl)tetrazol-1-yl]butanoic acid.
What is the SMILES notation for 3-methoxy-4-[5-(2,2,2-trifluoroethyl)tetrazol-1-yl]butanoic acid?
The canonical SMILES for 3-methoxy-4-[5-(2,2,2-trifluoroethyl)tetrazol-1-yl]butanoic acid is COC(CC(=O)O)Cn1nnnc1CC(F)(F)F.
What is the InChIKey of 3-methoxy-4-[5-(2,2,2-trifluoroethyl)tetrazol-1-yl]butanoic acid?
The InChIKey is YVXJBOKQDDNZDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3N4O3/c1-18-5(2-7(16)17)4-15-6(12-13-14-15)3-8(9,10)11/h5H,2-4H2,1H3,(H,16,17).
What are the key properties of 3-methoxy-4-[5-(2,2,2-trifluoroethyl)tetrazol-1-yl]butanoic acid?
3-methoxy-4-[5-(2,2,2-trifluoroethyl)tetrazol-1-yl]butanoic acid has a molecular weight of 268.19 g/mol, XLogP of 0.27, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-4-[5-(2,2,2-trifluoroethyl)tetrazol-1-yl]butanoic acid is sourced from PubChem (CID 103160396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).