C25H23NO — CID 10316069
2,2,4-trimethyl-5-phenyl-1,5-dihydrochromeno[3,4-f]quinoline (PubChem CID 10316069) has the molecular formula C25H23NO and a molecular weight of 353.47 g/mol. Its IUPAC name is 2,2,4-trimethyl-5-phenyl-1,5-dihydrochromeno[3,4-f]quinoline.
| Compound Name | 2,2,4-trimethyl-5-phenyl-1,5-dihydrochromeno[3,4-f]quinoline |
|---|---|
| PubChem CID | 10316069 |
| Molecular Formula | C25H23NO |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 2,2,4-trimethyl-5-phenyl-1,5-dihydrochromeno[3,4-f]quinoline |
| SMILES | CC1=CC(C)(C)Nc2ccc3c(c21)C(c1ccccc1)Oc1ccccc1-3 |
| InChI | InChI=1S/C25H23NO/c1-16-15-25(2,3)26-20-14-13-19-18-11-7-8-12-21(18)27-24(23(19)22(16)20)17-9-5-4-6-10-17/h4-15,24,26H,1-3H3 |
| InChIKey | KGVGNTCIQIYLQU-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |