About 4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-imidazol-2-yl]-N,N-diethylbutanamide
4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-imidazol-2-yl]-N,N-diethylbutanamide (PubChem CID 10316078) has the molecular formula C18H35N3O2Si
and a molecular weight of 353.58 g/mol. Its IUPAC name is 4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-imidazol-2-yl]-N,N-diethylbutanamide.
Molecular Properties
| Compound Name | 4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-imidazol-2-yl]-N,N-diethylbutanamide |
| PubChem CID | 10316078 |
| Molecular Formula | C18H35N3O2Si |
| Molecular Weight | 353.58 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-imidazol-2-yl]-N,N-diethylbutanamide |
| SMILES | CCN(CC)C(=O)CCCc1ncc(CO[Si](C)(C)C(C)(C)C)[nH]1 |
| InChI | InChI=1S/C18H35N3O2Si/c1-8-21(9-2)17(22)12-10-11-16-19-13-15(20-16)14-23-24(6,7)18(3,4)5/h13H,8-12,14H2,1-7H3,(H,19,20) |
| InChIKey | ZMZJDUOAKOGGNE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-imidazol-2-yl]-N,N-diethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-imidazol-2-yl]-N,N-diethylbutanamide?
The IUPAC name of 4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-imidazol-2-yl]-N,N-diethylbutanamide (CID 10316078) is 4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-imidazol-2-yl]-N,N-diethylbutanamide.
What is the SMILES notation for 4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-imidazol-2-yl]-N,N-diethylbutanamide?
The canonical SMILES for 4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-imidazol-2-yl]-N,N-diethylbutanamide is CCN(CC)C(=O)CCCc1ncc(CO[Si](C)(C)C(C)(C)C)[nH]1.
What is the InChIKey of 4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-imidazol-2-yl]-N,N-diethylbutanamide?
The InChIKey is ZMZJDUOAKOGGNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35N3O2Si/c1-8-21(9-2)17(22)12-10-11-16-19-13-15(20-16)14-23-24(6,7)18(3,4)5/h13H,8-12,14H2,1-7H3,(H,19,20).
What are the key properties of 4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-imidazol-2-yl]-N,N-diethylbutanamide?
4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-imidazol-2-yl]-N,N-diethylbutanamide has a molecular weight of 353.58 g/mol, XLogP of 4.12, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-imidazol-2-yl]-N,N-diethylbutanamide is sourced from PubChem (CID 10316078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).