C22H31NO3 — CID 10316298
hexyl 1-hexyl-2-oxoquinoline-4-carboxylate (PubChem CID 10316298) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is hexyl 1-hexyl-2-oxoquinoline-4-carboxylate.
| Compound Name | hexyl 1-hexyl-2-oxoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 10316298 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | hexyl 1-hexyl-2-oxoquinoline-4-carboxylate |
| SMILES | CCCCCCOC(=O)c1cc(=O)n(CCCCCC)c2ccccc12 |
| InChI | InChI=1S/C22H31NO3/c1-3-5-7-11-15-23-20-14-10-9-13-18(20)19(17-21(23)24)22(25)26-16-12-8-6-4-2/h9-10,13-14,17H,3-8,11-12,15-16H2,1-2H3 |
| InChIKey | TYODRULIFQKXPY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|