C19H26N4O4 — CID 1031632
ethyl 1-[3-[cyclopropyl(pyrazine-2-carbonyl)amino]propanoyl]piperidine-4-carboxylate (PubChem CID 1031632) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is ethyl 1-[3-[cyclopropyl(pyrazine-2-carbonyl)amino]propanoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[cyclopropyl(pyrazine-2-carbonyl)amino]propanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 1031632 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | ethyl 1-[3-[cyclopropyl(pyrazine-2-carbonyl)amino]propanoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CCN(C(=O)c2cnccn2)C2CC2)CC1 |
| InChI | InChI=1S/C19H26N4O4/c1-2-27-19(26)14-5-10-22(11-6-14)17(24)7-12-23(15-3-4-15)18(25)16-13-20-8-9-21-16/h8-9,13-15H,2-7,10-12H2,1H3 |
| InChIKey | JNTZOOWHNRWLJM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |