C16H23BrFNO — CID 103163219
1-(3-bromo-4-fluorophenyl)-2-(3-ethoxycyclobutyl)-N-ethylethanamine (PubChem CID 103163219) has the molecular formula C16H23BrFNO and a molecular weight of 344.27 g/mol. Its IUPAC name is 1-(3-bromo-4-fluorophenyl)-2-(3-ethoxycyclobutyl)-N-ethylethanamine.
| Compound Name | 1-(3-bromo-4-fluorophenyl)-2-(3-ethoxycyclobutyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 103163219 |
| Molecular Formula | C16H23BrFNO |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 1-(3-bromo-4-fluorophenyl)-2-(3-ethoxycyclobutyl)-N-ethylethanamine |
| SMILES | CCNC(CC1CC(OCC)C1)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C16H23BrFNO/c1-3-19-16(9-11-7-13(8-11)20-4-2)12-5-6-15(18)14(17)10-12/h5-6,10-11,13,16,19H,3-4,7-9H2,1-2H3 |
| InChIKey | MVFIIHBHFHQTLX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |