About N-octyl-5,6-diphenylpyridazin-3-amine
N-octyl-5,6-diphenylpyridazin-3-amine (PubChem CID 10316429) has the molecular formula C24H29N3
and a molecular weight of 359.52 g/mol. Its IUPAC name is N-octyl-5,6-diphenylpyridazin-3-amine.
Molecular Properties
| Compound Name | N-octyl-5,6-diphenylpyridazin-3-amine |
| PubChem CID | 10316429 |
| Molecular Formula | C24H29N3 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | N-octyl-5,6-diphenylpyridazin-3-amine |
| SMILES | CCCCCCCCNc1cc(-c2ccccc2)c(-c2ccccc2)nn1 |
| InChI | InChI=1S/C24H29N3/c1-2-3-4-5-6-13-18-25-23-19-22(20-14-9-7-10-15-20)24(27-26-23)21-16-11-8-12-17-21/h7-12,14-17,19H,2-6,13,18H2,1H3,(H,25,26) |
| InChIKey | JWGQYDRSKJXYBK-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-octyl-5,6-diphenylpyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-octyl-5,6-diphenylpyridazin-3-amine?
The IUPAC name of N-octyl-5,6-diphenylpyridazin-3-amine (CID 10316429) is N-octyl-5,6-diphenylpyridazin-3-amine.
What is the SMILES notation for N-octyl-5,6-diphenylpyridazin-3-amine?
The canonical SMILES for N-octyl-5,6-diphenylpyridazin-3-amine is CCCCCCCCNc1cc(-c2ccccc2)c(-c2ccccc2)nn1.
What is the InChIKey of N-octyl-5,6-diphenylpyridazin-3-amine?
The InChIKey is JWGQYDRSKJXYBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N3/c1-2-3-4-5-6-13-18-25-23-19-22(20-14-9-7-10-15-20)24(27-26-23)21-16-11-8-12-17-21/h7-12,14-17,19H,2-6,13,18H2,1H3,(H,25,26).
What are the key properties of N-octyl-5,6-diphenylpyridazin-3-amine?
N-octyl-5,6-diphenylpyridazin-3-amine has a molecular weight of 359.52 g/mol, XLogP of 6.58, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-octyl-5,6-diphenylpyridazin-3-amine is sourced from PubChem (CID 10316429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).