C16H28N2O2 — CID 103165034
1-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-2-(3-ethoxycyclobutyl)ethanone (PubChem CID 103165034) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 1-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-2-(3-ethoxycyclobutyl)ethanone.
| Compound Name | 1-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-2-(3-ethoxycyclobutyl)ethanone |
|---|---|
| PubChem CID | 103165034 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 1-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-2-(3-ethoxycyclobutyl)ethanone |
| SMILES | CCOC1CC(CC(=O)N2CC3CNCC3C2(C)C)C1 |
| InChI | InChI=1S/C16H28N2O2/c1-4-20-13-5-11(6-13)7-15(19)18-10-12-8-17-9-14(12)16(18,2)3/h11-14,17H,4-10H2,1-3H3 |
| InChIKey | UDUNACJOIJDGAJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |